ChemNet > CAS > 80866-80-4 2-Chloro-5-nitrobenzyl alcohol
80866-80-4 2-Chloro-5-nitrobenzyl alcohol
| Ürün Adı |
2-Chloro-5-nitrobenzyl alcohol |
| ingilizce adı |
2-Chloro-5-nitrobenzyl alcohol;(2-chloro-5-nitrophenyl)methanol |
| Moleküler Formülü |
C7H6ClNO3 |
| Molekül Ağırlığı |
187.5804 |
| InChI |
InChI=1/C7H6ClNO3/c8-7-2-1-6(9(11)12)3-5(7)4-10/h1-3,10H,4H2 |
| CAS kayıt numarası |
80866-80-4 |
| EINECS |
279-584-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.476g/cm3 |
| Ergime noktası |
74-79℃ |
| Kaynama noktası |
344.1°C at 760 mmHg |
| Kırılma indisi |
1.611 |
| Alevlenme noktası |
161.9°C |
| Buhar basıncı |
2.56E-05mmHg at 25°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
