ChemNet > CAS > 818-88-2 mono-methyl sebacate
818-88-2 mono-methyl sebacate
| Ürün Adı |
mono-methyl sebacate |
| ingilizce adı |
mono-methyl sebacate; Monomethyl sebacate~Sebacic acid monomethyl ester; Sebacic acid monomethyl ester; Methyl hydrogen sebacate (Monomethyl sebacate; Sebacic acid monomethyl ester); monomethyl sebacate; 10-methoxy-10-oxodecanoic acid |
| Moleküler Formülü |
C11H20O4 |
| Molekül Ağırlığı |
216.2741 |
| InChI |
InChI=1/C11H20O4/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13) |
| CAS kayıt numarası |
818-88-2 |
| EINECS |
212-458-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.038g/cm3 |
| Ergime noktası |
41-44℃ |
| Kaynama noktası |
332.5°C at 760 mmHg |
| Kırılma indisi |
1.453 |
| Alevlenme noktası |
115.4°C |
| Buhar basıncı |
2.8E-05mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
