ChemNet > CAS > 82796-69-8 (S)-1-(3-Methoxyphenyl)ethylamine
82796-69-8 (S)-1-(3-Methoxyphenyl)ethylamine
| Ürün Adı |
(S)-1-(3-Methoxyphenyl)ethylamine |
| ingilizce adı |
(S)-1-(3-Methoxyphenyl)ethylamine; (S)-m-Methoxy-alpha-methylbenzylamine; (1S)-1-(3-methoxyphenyl)ethanamine |
| Moleküler Formülü |
C9H13NO |
| Molekül Ağırlığı |
151.2056 |
| InChI |
InChI=1/C9H13NO/c1-7(10)8-4-3-5-9(6-8)11-2/h3-7H,10H2,1-2H3/t7-/m0/s1 |
| CAS kayıt numarası |
82796-69-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.003g/cm3 |
| Kaynama noktası |
234.6°C at 760 mmHg |
| Kırılma indisi |
1.522 |
| Alevlenme noktası |
94.7°C |
| Buhar basıncı |
0.0524mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R21/22:Harmful in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
