ChemNet > CAS > 84951-44-0 2-(1-Piperazinyl)-3-pyridinecarbonitrile
84951-44-0 2-(1-Piperazinyl)-3-pyridinecarbonitrile
| Ürün Adı |
2-(1-Piperazinyl)-3-pyridinecarbonitrile |
| ingilizce adı |
2-(1-Piperazinyl)-3-pyridinecarbonitrile; 1-(2-(3-Cyanopyridil))-piperazine; 2-Piperazinonicotinonitrile; 2-piperazin-1-ylpyridine-3-carbonitrile |
| Moleküler Formülü |
C10H12N4 |
| Molekül Ağırlığı |
188.2291 |
| InChI |
InChI=1/C10H12N4/c11-8-9-2-1-3-13-10(9)14-6-4-12-5-7-14/h1-3,12H,4-7H2 |
| CAS kayıt numarası |
84951-44-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.22g/cm3 |
| Kaynama noktası |
388°C at 760 mmHg |
| Kırılma indisi |
1.605 |
| Alevlenme noktası |
188.4°C |
| Buhar basıncı |
3.17E-06mmHg at 25°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
