85-02-9 5,6-Benzoquinoline
Ürün Adı |
5,6-Benzoquinoline |
ingilizce adı |
5,6-Benzoquinoline; beta-Naphthoquinoline; 1-Azaphenanthrene; Benzo[f]quinoline; Benzoquinoline; benzo(f)quinoline |
Moleküler Formülü |
C13H9N |
Molekül Ağırlığı |
179.2173 |
InChI |
InChI=1/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H |
CAS kayıt numarası |
85-02-9 |
EINECS |
201-582-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.187g/cm3 |
Ergime noktası |
89-91℃ |
Kaynama noktası |
350.4°C at 760 mmHg |
Kırılma indisi |
1.726 |
Alevlenme noktası |
155.9°C |
Buhar basıncı |
8.89E-05mmHg at 25°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|