ChemNet > CAS > 86129-63-7 ethyl 2,4-dichloro-6-methylnicotinate
86129-63-7 ethyl 2,4-dichloro-6-methylnicotinate
Ürün Adı |
ethyl 2,4-dichloro-6-methylnicotinate |
ingilizce adı |
ethyl 2,4-dichloro-6-methylnicotinate; ethyl 2,4-dichloro-6-methylpyridine-3-carboxylate; 2,4-dichloro-6-methylpyridine-3-carboxylate |
Moleküler Formülü |
C9H9Cl2NO2 |
Molekül Ağırlığı |
234.0793 |
InChI |
InChI=1/C9H9Cl2NO2/c1-3-14-9(13)7-6(10)4-5(2)12-8(7)11/h4H,3H2,1-2H3 |
CAS kayıt numarası |
86129-63-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.32g/cm3 |
Ergime noktası |
56℃ |
Kaynama noktası |
298.2°C at 760 mmHg |
Kırılma indisi |
1.537 |
Alevlenme noktası |
134.1°C |
Buhar basıncı |
0.00129mmHg at 25°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|