ChemNet > CAS > 868-54-2 2-Amino-1-propene-1,1,3-tricarbonitrile
868-54-2 2-Amino-1-propene-1,1,3-tricarbonitrile
| Ürün Adı |
2-Amino-1-propene-1,1,3-tricarbonitrile |
| ingilizce adı |
2-Amino-1-propene-1,1,3-tricarbonitrile; 2-aminoprop-1-ene-1,1,3-tricarbonitrile |
| Moleküler Formülü |
C6H4N4 |
| Molekül Ağırlığı |
132.1228 |
| InChI |
InChI=1/C6H4N4/c7-2-1-6(10)5(3-8)4-9/h5,10H,1H2/b10-6+ |
| CAS kayıt numarası |
868-54-2 |
| EINECS |
212-777-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.13g/cm3 |
| Ergime noktası |
171-173℃ |
| Kaynama noktası |
454.9°C at 760 mmHg |
| Kırılma indisi |
1.565 |
| Alevlenme noktası |
228.9°C |
| Buhar basıncı |
1.84E-08mmHg at 25°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|
