ChemNet > CAS > 931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
Ürün Adı |
1,2-Cyclohexanediol, mixture of cis and trans |
ingilizce adı |
1,2-Cyclohexanediol, mixture of cis and trans; 1,2-Cyclohexanediol, cis/trans-mix; 1,2-Cyclohexanediol; 1,2-Cyclohexandiol |
Moleküler Formülü |
C6H12O2 |
Molekül Ağırlığı |
116.16 |
InChI |
InChI=1/C6H12O2/c7-5-3-1-2-4-6(5)8/h5-8H,1-4H2 |
CAS kayıt numarası |
931-17-9 |
EINECS |
213-229-8 |
Moleküler Yapısı |
|
Ergime noktası |
73-77℃ |
Kaynama noktası |
118-120℃ (10 mmHg) |
Suda çözünürlük |
soluble |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S23:;
S24/25:;
|
|