ChemNet > CAS > 934-00-9 3-Methoxycatechol
934-00-9 3-Methoxycatechol
| Ürün Adı |
3-Methoxycatechol |
| ingilizce adı |
3-Methoxycatechol; Pyrogallol monomethyl ether; pyrogallol-1-methyl ether; 2,3-Dihydroxyanisole~Pyrogallol 1-methyl ether; 3-methoxybenzene-1,2-diol |
| Moleküler Formülü |
C7H8O3 |
| Molekül Ağırlığı |
140.1366 |
| InChI |
InChI=1/C7H8O3/c1-10-6-4-2-3-5(8)7(6)9/h2-4,8-9H,1H3 |
| CAS kayıt numarası |
934-00-9 |
| EINECS |
213-276-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.27g/cm3 |
| Ergime noktası |
39-43℃ |
| Kaynama noktası |
268.1°C at 760 mmHg |
| Kırılma indisi |
1.579 |
| Alevlenme noktası |
119.5°C |
| Buhar basıncı |
0.00476mmHg at 25°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
