ChemNet > CAS > 937-00-8 3-(trifluoromethyl)thiophenol
937-00-8 3-(trifluoromethyl)thiophenol
| Ürün Adı |
3-(trifluoromethyl)thiophenol |
| ingilizce adı |
3-(trifluoromethyl)thiophenol; 3-(Trifluoromethyl)benzenethiol; 1-bromo-5-chloro-2-fluoro-4-methylbenzene; 3-Trifluoromethyl thiophenol |
| Moleküler Formülü |
C7H5BrClF |
| Molekül Ağırlığı |
223.47 |
| InChI |
InChI=1/C7H5BrClF/c1-4-2-7(10)5(8)3-6(4)9/h2-3H,1H3 |
| CAS kayıt numarası |
937-00-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.618g/cm3 |
| Kaynama noktası |
221.1°C at 760 mmHg |
| Kırılma indisi |
1.545 |
| Alevlenme noktası |
87.5°C |
| Buhar basıncı |
0.162mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
