94-81-5 MCPB
Ürün Adı |
MCPB |
ingilizce adı |
MCPB; 4-(4-Chloro-o-tolyloxy)butyric acid; 2,4-MCPB; 4-(4-Chloro-2-methylphenoxy)butyric acid; MCPB; 4-(2-Methyl-4-chlorophenoxy)butyric acid; 2-(4-chloro-2-methylphenoxy)butanoic acid |
Moleküler Formülü |
C11H13ClO3 |
Molekül Ağırlığı |
228.6721 |
InChI |
InChI=1/C11H13ClO3/c1-3-9(11(13)14)15-10-5-4-8(12)6-7(10)2/h4-6,9H,3H2,1-2H3,(H,13,14) |
CAS kayıt numarası |
94-81-5 |
EINECS |
202-365-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.228g/cm3 |
Kaynama noktası |
345.1°C at 760 mmHg |
Kırılma indisi |
1.536 |
Alevlenme noktası |
162.5°C |
Buhar basıncı |
2.39E-05mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R22:Harmful if swallowed.;
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|