ChemNet > CAS > 95735-63-0 2-(3,4-Dimethoxyphenylthio)acetic acid
95735-63-0 2-(3,4-Dimethoxyphenylthio)acetic acid
| Ürün Adı |
2-(3,4-Dimethoxyphenylthio)acetic acid |
| ingilizce adı |
2-(3,4-Dimethoxyphenylthio)acetic acid; 2-[(3,4-dimethoxyphenyl)thio]acetic acid; [(3,4-dimethoxyphenyl)sulfanyl]acetic acid; [(3,4-dimethoxyphenyl)sulfanyl]acetate |
| Moleküler Formülü |
C10H11O4S |
| Molekül Ağırlığı |
227.2575 |
| InChI |
InChI=1/C10H12O4S/c1-13-8-4-3-7(5-9(8)14-2)15-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1 |
| CAS kayıt numarası |
95735-63-0 |
| Moleküler Yapısı |
|
| Ergime noktası |
101-103℃ |
| Kaynama noktası |
376.4°C at 760 mmHg |
| Alevlenme noktası |
181.4°C |
| Buhar basıncı |
2.47E-06mmHg at 25°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
