ChemNet > CAS > 96-04-8 2,3-heptanedione
96-04-8 2,3-heptanedione
| Ürün Adı |
2,3-heptanedione |
| ingilizce adı |
2,3-heptanedione;2,3-Heptanedione; Acetyl pentanoyl; Acetyl valeryl; FEMA No. 2543; NSC 31668; UNII-DK55DDE86P; Valerylacetyl; heptane-2,3-dione |
| Moleküler Formülü |
C7H12O2 |
| Molekül Ağırlığı |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-3-4-5-7(9)6(2)8/h3-5H2,1-2H3 |
| CAS kayıt numarası |
96-04-8 |
| EINECS |
202-472-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.926g/cm3 |
| Kaynama noktası |
149.7°C at 760 mmHg |
| Kırılma indisi |
1.413 |
| Alevlenme noktası |
45°C |
| Buhar basıncı |
3.98mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R10:Flammable.;
|
| Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
