96-20-8 (±)-2-Amino-1-butanol
Ürün Adı |
(±)-2-Amino-1-butanol |
ingilizce adı |
(±)-2-Amino-1-butanol; (-)-2-Aminobutanol; .+/-.-2-Amino-1-butanol; 1-butanol, 2-amino-; 2-Aminobutan-1-ol; 2-Amino-1-butanol; 2-aminobutan-2-ol; 2-Amino-1-butanol |
Moleküler Formülü |
C4H12NO |
Molekül Ağırlığı |
90.1436 |
InChI |
InChI=1/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3/p+1/t4-/m1/s1 |
CAS kayıt numarası |
96-20-8 |
EINECS |
202-488-2 |
Moleküler Yapısı |
|
Ergime noktası |
-2℃ |
Kaynama noktası |
177.2°C at 760 mmHg |
Alevlenme noktası |
82.2°C |
Buhar basıncı |
0.319mmHg at 25°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|