Details for 2-Thiobenzyl nicotinic acid
![](/images/home/newal1.gif)
2-Thiobenzyl nicotinic acid
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
112811-90-2 |
EC NO: |
|
Molecular Formula: |
C13H11NO2S |
Molecular Weight: |
245.2969 |
Specification: |
|
InChI: |
InChI=1/C13H11NO2S/c15-13(10-5-3-7-14-8-10)16-9-11-4-1-2-6-12(11)17/h1-5,7-8H,6,9H2 |
Synonyms: |
2-[(Phenylmethyl)thio]-3-pyridinecarboxylic acid;2-Thiobenzylnicotinic acid;2-Benzylsulfanyl-nicotinic acid;2-(benzylsulfanyl)pyridine-3-carboxylic acid;biphenyl-2-ylboronic acid;ethyl 2-(trifluoromethyl)pyridine-3-carboxylate; |
Molecular Structure: |
![2-Thiobenzyl nicotinic acid 112811-90-2](https://images-a.chemnet.com/suppliers/chembase/966/203966.gif) |
if you are sourcing 2-Thiobenzyl nicotinic acid from China ,just feel free to inquire