Details for 4,4'-Dimethyl diphenyl sulfoxide
![](/images/home/newal1.gif)
4,4'-Dimethyl diphenyl sulfoxide
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
1774-35-2 |
EC NO: |
217-203-7 |
Molecular Formula: |
C14H14OS |
Molecular Weight: |
230.3254 |
Specification: |
|
InChI: |
InChI=1/C14H14OS/c1-11-3-7-13(8-4-11)16(15)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
Synonyms: |
Tolylsulfoxide;bis(p-tolyl)sulphoxide;4,4-Dimethyl diphenyl sulfoxide;TOLYL SULPHOXIDE1,1'-sulfinylbis(4-methylbenzene);4,4'-Dimethyldiphenylsulfoxide;Bis-(P-Tolyl) Sulfoxide; |
Molecular Structure: |
![4,4'-Dimethyl diphenyl sulfoxide 1774-35-2](https://images-a.chemnet.com/suppliers/chembase/213/21313.gif) |
if you are sourcing 4,4'-Dimethyl diphenyl sulfoxide from China ,just feel free to inquire