Details for 4-(Methylthio) phenyl acetic acid ethyl ester

4-(Methylthio) phenyl acetic acid ethyl ester
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
14062-27-2 |
EC NO: |
|
Molecular Formula: |
C11H14O2S |
Molecular Weight: |
210.2927 |
Specification: |
|
InChI: |
InChI=1/C11H14O2S/c1-3-13-11(12)8-9-4-6-10(14-2)7-5-9/h4-7H,3,8H2,1-2H3 |
Synonyms: |
4-(methylthio)phenylacetic acid ethyl ester;ethyl [4-(methylsulfanyl)phenyl]acetate; |
Molecular Structure: |
 |
if you are sourcing 4-(Methylthio) phenyl acetic acid ethyl ester from China ,just feel free to inquire