Details for 4-Methylthio phenyl acetic acid

4-Methylthio phenyl acetic acid
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
16188-55-9 |
EC NO: |
|
Molecular Formula: |
C9H10OS |
Molecular Weight: |
166.2401 |
Specification: |
|
InChI: |
InChI=1/C9H10OS/c1-7-2-4-8(5-3-7)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
Synonyms: |
(4-methylsulfanyl-phenyl)-acetic acid;2-(4-(methylthio)phenyl)acetic acid;4-(Methylthio)benzeneacetic acid;4-Methylthiophenylacetic acid;4-(methylthio)phenyl acetic acid;4-(methylsulfanyl)phenyl acetate;(4-methylphenyl)ethanethioic S-acid;4-(Methylthio) phenylacetic acid; |
Molecular Structure: |
 |
if you are sourcing 4-Methylthio phenyl acetic acid from China ,just feel free to inquire