Details for 1,3,5-Tribromo benzene

1,3,5-Tribromo benzene
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
626-39-1 |
EC NO: |
210-947-3 |
Molecular Formula: |
C6H3Br3 |
Molecular Weight: |
314.8 |
Specification: |
|
InChI: |
InChI=1/C6H3Br3/c7-4-1-5(8)3-6(9)2-4/h1-3H |
Packing: |
25kgs net cardboard drum |
Product description:
CAS Number: 626-39-1Description: bp: 271癈mp: 118-120癈SpecificationAppearance: light yellow crystal Content: 98.5% minMelting point: 118-120癈 Boiling point: 271癈Moisture: 0.5% max
|
Synonyms: |
Tribromobenzene;1,3,5-tribromo benzene;Benzene,1,3,5-tribromo-;1,3,5-tribromo-benzene;K0337; |
Molecular Structure: |
 |
if you are sourcing 1,3,5-Tribromo benzene from China ,just feel free to inquire