111Category: |
Intermediates |
|
CAS NO: |
123-54-6 |
EC NO: |
204-634-0 |
Molecular Formula: |
C5H8O2 |
Molecular Weight: |
100.1158 |
Specification: |
|
InChI: |
InChI=1/C5H8O2/c1-4(6)3-5(2)7/h3,6H,1-2H3/b4-3- |
Packing: |
Product description:Colorless or light yellow, easy flowing transparent liquid. |
Product description:
CAS: 123-54-6 MW:100.12EC NO.: 204-634-0MF: C5H8O2Packing:Product description:Colorless or light yellow, easy flowing transparent liquid. Use:It has wide applications. 1. Mainly used in the synthesis of pharmacy and intermediates; 2. Used in the synthesizing of veterinary medicine and feed additives; 3. Used as the additive for solvent of cellulose acetate, for gasoline and lubricating oil and binding material for electroplating.
|
Synonyms: |
Acetylacetone;pentane-2,4-dione;pentane-2,3-dione;(3E)-4-hydroxypent-3-en-2-one;(3Z)-4-hydroxypent-3-en-2-one;Acetyl Acetone;2,4-Pentane dione;2,4-Pentandione; |
Molecular Structure: |
 |