Details for 2,5-Thiophenedicarboxylic acid
2,5-Thiophenedicarboxylic acid
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
4282-31-9 |
| EC NO: |
224-284-2 |
| Molecular Formula: |
C6H2O4S |
| Molecular Weight: |
170.1438 |
| Specification: |
|
| InChI: |
InChI=1/C6H4O4S/c7-5(8)3-1-2-4(11-3)6(9)10/h1-2H,(H,7,8)(H,9,10)/p-2 |
| Packing: |
25kg bags |
| Synonyms: |
Thiophene-2,5-dicarboxylic acid;Thiophene-2,5-Dicarboxyl Acid;thiophene-2,5-dicarboxylate; |
| Molecular Structure: |
 |
if you are sourcing 2,5-Thiophenedicarboxylic acid from China ,just feel free to inquire
CN
China Suppliers > hebeismart > 
Search Product