year
111Category: | Intermediates |
|
|
CAS NO: | 613-33-2 | ||
EC NO: | 210-337-7 | ||
Molecular Formula: | C14H14 | ||
Molecular Weight: | 182.261 | ||
Specification: | |||
InChI: | InChI=1/C14H14/c1-11-3-7-13(8-4-11)14-9-5-12(2)6-10-14/h3-10H,1-2H3 | ||
Product description: CAS NO.: 613-33-2 MW:182.26EC NO.MF: C14H14Packing:Product description:Physical appearance: White crystalline powderAssay:≥99.0%Moisture:≤0.1%Melting point: 120-122°C Use:Used in pharmacy、Macromolecule materials and synthesize etc. |
|||
Uses: | Used in pharmacy、Macromolecule materials and synthesize etc. | ||
Synonyms: | p,p-Bitoluene;4,4-Dimethyldiphenyl;4,4'-dimethyl-1,1'-biphenyl;p,p'-Bitoluene; | ||
Molecular Structure: |
![]() |