Details for 4-Nitrobenzoic acid
![](/images/home/newal1.gif)
4-Nitrobenzoic acid
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
62-23-7 |
EC NO: |
200-526-2 |
Molecular Formula: |
C7H4NO4 |
Molecular Weight: |
166.1115 |
Specification: |
|
InChI: |
InChI=1/C7H5NO4/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4H,(H,9,10)/p-1 |
Packing: |
25kg bag |
Product description:
Formula CAS No
C7H5NO4 62-23-7
|
Synonyms: |
P-Nitrobenzoic acid;4-nitrobenzoate;Para Nitrobenzoic acid;PNBA; |
Molecular Structure: |
![4-Nitrobenzoic acid 62-23-7](https://images-a.chemnet.com/suppliers/chembase/223/2231.gif) |
if you are sourcing 4-Nitrobenzoic acid from China ,just feel free to inquire