Details for 5-amino-1,3-isophthalic acid
5-amino-1,3-isophthalic acid
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
99-31-0 |
| EC NO: |
202-748-5 |
| Molecular Formula: |
C8H5NO4 |
| Molecular Weight: |
179.1307 |
| Specification: |
|
| InChI: |
InChI=1/C8H7NO4/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3H,9H2,(H,10,11)(H,12,13)/p-2 |
| Synonyms: |
5-Aminobenzene-1,3-dicarboxylic acid;5-AIPA;5-aminobenzene-1,3-dicarboxylate;5-Amino-1,3-Benzenedicarboxylic Acid;5-Amino-1,3-Isophthalic Acid;Aminoisophthalic(5-) Acid;5-amino-3-benzene dicarboxylic acid; |
| Molecular Structure: |
 |
if you are sourcing 5-amino-1,3-isophthalic acid from China ,just feel free to inquire
CN
China Suppliers > hebeismart > 
Search Product