Details for 6-Chloronicotinic Acid
6-Chloronicotinic Acid
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
5326-23-8 |
| EC NO: |
226-201-5 |
| Molecular Formula: |
C6H4ClNO2 |
| Molecular Weight: |
157.55626 |
| Specification: |
|
| InChI: |
InChI=1/C6H4ClNO2/c7-5-2-1-4(3-8-5)6(9)10/h1-3H,(H,9,10)/p-1 |
| Synonyms: |
6-Chloropyridine-3-carboxylic acid;3-Pyridinecarboxylic acid, 6-chloro-;6-chloropyridine-3-carboxylate;RARECHEM AL BO 0729;TIMTEC-BB SBB004004;6-chloro-nicotinic acid;6-chloromicotinic; |
| Molecular Structure: |
 |
if you are sourcing 6-Chloronicotinic Acid from China ,just feel free to inquire
CN
China Suppliers > hebeismart > 
Search Product