| 111Category: |
Inorganic chemicals |
|
| CAS NO: |
66215-27-8 |
| EC NO: |
266-257-8 |
| Molecular Formula: |
C6H10N6 |
| Molecular Weight: |
166.18 |
| Specification: |
|
| InChI: |
InChI=1/C6H10N6/c7-4-10-5(8)12-6(11-4)9-3-1-2-3/h3H,1-2H2,(H5,7,8,9,10,11,12) |
| Packing: |
25kg fiber drums. |
| Uses: |
This product is a distinctive insect growth regulating reagent,it may as feed additive,which can effectively stop the normal growth of insects from its larva stage.Because the function method of its active component is highly selective,it may not do any h |
| Synonyms: |
n-cyclopropyl-1,3,5-triazine-2,4,6-triamine; 2-cyclopropylamino-4,6-diamino-s-triazine; diamino-6-(cyclopropylamino)-s-triazine; cyclopropyl-1,3,5-triazine-2,4,6-triamine; cyclopropylmelamine; larvadex; oms-2014; trigard; |
| Molecular Structure: |
 |
CN
China Suppliers > hebeismart > 
Search Product