Details for Ethyl 2-chloropropionate
Ethyl 2-chloropropionate
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
535-13-7 |
| EC NO: |
208-610-0 |
| Molecular Formula: |
C5H9ClO2 |
| Molecular Weight: |
136.5768 |
| Specification: |
|
| InChI: |
InChI=1/C5H9ClO2/c1-3-8-5(7)4(2)6/h4H,3H2,1-2H3/t4-/m1/s1 |
| Packing: |
100kg iron drum |
| Synonyms: |
2-Chloropropionic acid ethyl ester;Sub-Isopropyl Malonate;3-Nitrosalicyclic Acid;ethyl 2-chloropropanoate;ethyl (2S)-2-chloropropanoate;ethyl (2R)-2-chloropropanoate; |
| Molecular Structure: |
 |
if you are sourcing Ethyl 2-chloropropionate from China ,just feel free to inquire
CN
China Suppliers > hebeismart > 
Search Product