Details for Indoline

Indoline
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
496-15-1 |
EC NO: |
207-816-8 |
Molecular Formula: |
C8H9N |
Molecular Weight: |
119.1638 |
Specification: |
|
InChI: |
InChI=1/C8H9N/c1-2-4-8-7(3-1)5-6-9-8/h1-4,9H,5-6H2 |
Packing: |
200kgs net iron drum |
Product description:
Molecular Formula: C8H9NCAS Number: 496-15-1Description: Density: 1.063 g/ml at 25癈bP: 220-221癈Fp: 92癈SpecificationAppearance: yellow transparent liquidChromatogram purity: 98% minWater content: 0.3% max
|
Synonyms: |
2,3-Dihydroindole;IDN;2,3-dihydro-1H-indole; |
Molecular Structure: |
 |
if you are sourcing Indoline from China ,just feel free to inquire