Details for Iso-phthalic acid
Iso-phthalic acid
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
121-91-5 |
| EC NO: |
204-506-4 |
| Molecular Formula: |
C8H4O4 |
| Molecular Weight: |
164.1161 |
| Specification: |
|
| InChI: |
InChI=1/C8H6O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H,(H,9,10)(H,11,12)/p-2 |
| Synonyms: |
Benzene-1,3-dicarboxylic acid;Isophthalic Acid/Benzene-1,3-dicarboxylic acid(IPA);benzene-1,3-dicarboxylate;m-Phthalic acid; |
| Molecular Structure: |
 |
if you are sourcing Iso-phthalic acid from China ,just feel free to inquire
CN
China Suppliers > hebeismart > 
Search Product