Details for methyl 2-benzamidoacetate
methyl 2-benzamidoacetate
| 111Category: |
Intermediates |
|
| CAS NO: |
1205-08-9 |
| EC NO: |
|
| Molecular Formula: |
C10H11NO3 |
| Molecular Weight: |
193.1992 |
| Specification: |
|
| InChI: |
InChI=1/C10H11NO3/c1-14-9(12)7-11-10(13)8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,11,13) |
| Synonyms: |
methyl 2-benzamidoacetate;Hippurate methyl ester;Hippuric acid, methyl ester;Methyl (benzoylamino)acetate;Methyl ester of Hippuric acid;Methyl hippurate;Methyl N-benzoylglycinate;N-Benzoylglycine Methyl Ester; |
| Molecular Structure: |
 |
if you are sourcing methyl 2-benzamidoacetate from China ,just feel free to inquire
CN
China Suppliers > hebeismart > 
Search Product