Details for Methoxyacetic acid

Methoxyacetic acid
Category: |
Intermediates |
|
CAS NO: |
625-45-6 |
EC NO: |
210-894-6 |
Molecular Formula: |
C3H5O3 |
Molecular Weight: |
89.0705 |
Specification: |
|
InChI: |
InChI=1/C3H6O3/c1-6-2-3(4)5/h2H2,1H3,(H,4,5)/p-1 |
Usage: |
The intermediate of Metalaxyl and Metalaxyl-M |
Synonyms: |
Methoxyactic acid;2-methoxyacetic;2-Methoxyacetic acid;2-methoxyaceticacid;CH3OCH2COOH;Glycollicacid,methylether
methoxy-aceticaci;Methoxyethanoic acid;Methylglycolicacid;METHOXYACETIC ACID;Methoxyaceticacid;Methoxyacetic
Acetic acid;Methoxyessigsure;methoxy acetic acid;methoxyacetate; |
Molecular Structure: |
 |
if you are sourcing Methoxyacetic acid from China ,just feel free to inquire