111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
102-76-1 |
EC NO: |
203-051-9 |
Molecular Formula: |
C9H14O6 |
Molecular Weight: |
218.2039 |
Specification: |
Content: ≥ 99.5% |
InChI: |
InChI=1/C9H14O6/c1-6(10)13-4-9(15-8(3)12)5-14-7(2)11/h9H,4-5H2,1-3H3 |
Packing: |
53 gallon steel drum with net weight 240kgs. |
Product description:
|
C9H14O6 |
|
218.21 |
|
102-76-1 |
|
CH3COOCH2CH(CH3)OCH3 |
|
1,2,3-Propanetriol triacetate;Triacetin |
Content: |
≥ 99.5%
|
|
Mainly used in special plasticizer for cigarette filter tips. |
|
Item |
Unin |
Standard |
|
% |
≥ 99.5 |
Acidity(As HAc) |
% |
≤0.02 |
Moisture |
% |
≤0.05 |
Color |
Pt-Co |
≤15 |
Refractive Index (20℃) |
|
1.430~1.434 |
Specific Gravity (20℃) |
|
1.155~1.163 | |
|
53 gallon steel drum with net weight 240kgs. |
|
Uses: |
Mainly used in special plasticizer for cigarette filter tips. |
Synonyms: |
1,2,3-Propanetriol triacetate;Triacetine;Glycerol triacetate;Glyceryl triacetate;propane-1,2,3-triyl triacetate;1,2,3-propanedioltriacetate; |
Molecular Structure: |
|