Details for M-chlorophenylacetic acid

M-chlorophenylacetic acid
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
1878-65-5 |
| EC NO: |
217-520-0 |
| Molecular Formula: |
C8H7ClO2 |
| Molecular Weight: |
170.5856 |
| Specification: |
Content ≥99 |
| InChI: |
InChI=1/C8H7ClO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
| Packing: |
25kg/cardboard drum |
Product description:
This product(m-ClC6H4CH2COOH) is white powder crystal,melting point:77-78.5℃ |
| Synonyms: |
3-Chloropnenylacetic Acid;M-chlorophenylacetic acid ;(3-chlorophenyl)acetate;meta chlorophenylacetic acid |
| Molecular Structure: |
 |
if you are sourcing M-chlorophenylacetic acid from China ,just feel free to inquire