Details for 2-anmino-6-methylbenzoic acid
![](/images/home/newal1.gif)
2-anmino-6-methylbenzoic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
4389-50-8 |
EC NO: |
|
Molecular Formula: |
C8H8NO2 |
Molecular Weight: |
150.1552 |
Specification: |
|
InChI: |
InChI=1/C8H9NO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,9H2,1H3,(H,10,11)/p-1 |
Synonyms: |
6-AMINO-O-TOLUIC ACID;6-METHYLANTHRANILIC ACID;Benzoic acid, 2-amino-6-methyl- (9CI);6-AMINO-O-TOLUICACID;2-anmino-6-methylbenzoic acid;2-amino-6-methylbenzoate; |
Molecular Structure: |
![2-anmino-6-methylbenzoic acid 4389-50-8](https://images-a.chemnet.com/suppliers/chembase/294/294432_1.gif) |
if you are sourcing 2-anmino-6-methylbenzoic acid from China ,just feel free to inquire