Details for Tetraethyl ammonium Chloride

Tetraethyl ammonium Chloride
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
56-34-8 |
| EC NO: |
200-267-5 |
| Molecular Formula: |
C8H20N·Cl |
| Molecular Weight: |
165.706 |
| Specification: |
|
| InChI: |
InChI=1/C6H15N.ClH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H/p-1 |
| Synonyms: |
Tetraethyl Ammonium Chloride;N,N,N-triethylethanaminium chloride;ethanamine, N,N-diethyl-, chloride (1:1); |
| Molecular Structure: |
 |
if you are sourcing Tetraethyl ammonium Chloride from China ,just feel free to inquire