Details for Isoamyl alconol

Isoamyl alconol
111Category: |
Organic chemicals and Derivatives/Alcohol and aether compounds |
|
CAS NO: |
123-51-3 |
EC NO: |
204-633-5 |
Molecular Formula: |
C5H12O |
Molecular Weight: |
88.1482 |
Specification: |
|
InChI: |
InChI=1/C5H12O/c1-5(2)3-4-6/h5-6H,3-4H2,1-2H3 |
Synonyms: |
Isoamyl Alcohol;Isopentanol;Isopentyl Alcohol;3-Methyl-1-Butanol;(1s-Exo, Exo-3-(N-(3,5-Dimethylphenyl)Benzenesulfonamide)Iso-Borneol;Natural Isoamyl Alcohol;Natural 3-Methylbutanol;Isoamyl Alconol;2-methylbutan-1-ol;2,2-dimethylbutanoic acid;3-methylbutan-1-ol;3-methylbutanol;3-Methyl Butanol; |
Molecular Structure: |
 |
if you are sourcing Isoamyl alconol from China ,just feel free to inquire