Details for Magnesium Lactate

Magnesium Lactate
111Category: |
Catalyst and Auxiliary |
|
CAS NO: |
18917-93-6 |
EC NO: |
242-671-4 |
Molecular Formula: |
C3H5MgO3 |
Molecular Weight: |
113.3745 |
Specification: |
|
InChI: |
InChI=1/C3H6O3.Mg/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+2/p-1 |
Synonyms: |
¦Á-lactic acid magnesium salt;magnesium bis(2-hydroxypropanoate);propanoate, 2-hydroxy-, magnesium salt (1:1);Magnesium L-Lactate Trihydrate; |
Molecular Structure: |
 |
if you are sourcing Magnesium Lactate from China ,just feel free to inquire