Details for Glycol Ether EM
Glycol Ether EM
111Category: |
Organic chemicals and Derivatives/Alcohol and aether compounds |
|
CAS NO: |
109-86-4 |
EC NO: |
203-713-7 |
Molecular Formula: |
C3H8O2 |
Molecular Weight: |
76.0944 |
Specification: |
|
InChI: |
InChI=1/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3 |
Synonyms: |
2ME;Ethylene Glycol Monomethyl Ether;Dowanol Em;EGM;EGME;Ektasolve;Ethylene Glycol Methyl Ether;Ethylene Glycol Mono Methyl Ether;Glycol Ether Em;Glycol Monomethyl Ether;Glycomethyl Ether;Jeffersol Em;MECS;Methoxyethanol, 2-;Methoxyhydroxyethane;Methyl Cellosolve;Methyl 'Cellosolve';Methyl Ethoxol;1-methoxyethanol;ethane-1,2-diol-methoxyethene (1:1);EM; |
Molecular Structure: |
|
if you are sourcing Glycol Ether EM from Germany ,just feel free to inquire