Details for Methyl Propyl Ketone
![](/images/home/newal1.gif)
Methyl Propyl Ketone
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
107-87-9 |
EC NO: |
203-528-1 |
Molecular Formula: |
C5H10O |
Molecular Weight: |
86.133 |
Specification: |
|
InChI: |
InChI=1/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3 |
Synonyms: |
Methyl propyl ketone;METHYL N-PROPYLKETON;METHYL N-PROPYL KETONE;ETHYLACETONE;FEMA 2842;PENTAN-2-ONE;2-Oxopentane;2-Pentanon;3,5-dimethylheptan-4-one;2-Pentanone(Methyl propyl ketone); |
Molecular Structure: |
![Methyl Propyl Ketone 107-87-9](https://images-a.chemnet.com/suppliers/chembase/187/1870.gif) |
if you are sourcing Methyl Propyl Ketone from Germany ,just feel free to inquire