111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
137-40-6 |
EC NO: |
205-290-4 |
Molecular Formula: |
C3H5O2Na |
Molecular Weight: |
96.0612 |
Specification: |
|
InChI: |
InChI:1S/C3H6O2.Na/c1-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1 |
Product description:
Molecular formula |
C3H5NaO2 |
Molecular weight |
96.06 |
Propertie |
white crystal , granule or crystalline powder , odorless or slight odor of propionic acid |
Uses |
preservative, anti-fungus agent of food and feed . |
Dosage |
1, GB2760-96(g/kg): cake 2.5.
2, FAO/WHO(1984):cheese 3000mg/kg. |
Limit |
preservative. ADI is limitless |
Packing |
double-layer PE film food bag , net wt 25kg . |
Quality standard |
Index name |
HG2922-1999 |
FAO/WHO 1995 |
FCCIV |
E281 |
Assay(dry) %≤ |
99.0~100.5 |
99.0 |
99.0~100.5 |
99.0 |
Water insoluble matter %≤ |
|
0.1 |
|
|
PH 10% |
|
7.5~10.5 |
|
8.0~10.5 |
Alkalinity(Na2CO3) %≤ |
passed |
|
passed |
|
Loss on heat %≤ |
1.0 |
5.0 |
|
|
Heavy metals (as Pb) %≤ |
0.001 |
10mg/kg |
0.001 |
0.001 |
Fe %≤ |
0.003 |
50mg/kg |
0.003 |
0.003 |
As( as As2O3) %≤ |
0.0003 |
3mg/kg |
|
0.0003 |
Moisture(KF) %≤ |
|
|
1.0 |
1.0
|
|
|
Synonyms: |
Sodium propionate;propionic acid sodium type I;propionic acid sodium insect cell*culture tested;Propanoic acid, sodium salt;sodium propanoate;calcium dipropanoate;propanoate; |
Molecular Structure: |
|