Details for DMSO

DMSO
| Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
67-68-5 |
| EC NO: |
200-664-3 |
| Molecular Formula: |
C2H6OS |
| Molecular Weight: |
78.12 |
| Specification: |
|
| InChI: |
InChI=1/C2H6OS/c1-4(2)3/h1-2H3 |
| Synonyms: |
Dimethyl sulfoxide;DMSO;Methyl sulphoxide;methyl sulfoxide B&J brand 1 L;methyl sulfoxide absolute over molecular sieve (H2O <0.01%);Diemthyl Sulfoxide;Dimethyl Sulfoxide BP;Dimethyl sulphoxide;DMSO/NMP (Dimethylsulfoxide/1-Methyl-2-pyrrolidone);DMSO;Dimethylsulfoxide Sulfinylbis; |
| Molecular Structure: |
 |
if you are sourcing DMSO from China ,just feel free to inquire