Details for Trimethyl orthoformate
![](/images/home/newal1.gif)
Trimethyl orthoformate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
149-73-5 |
EC NO: |
205-745-7 |
Molecular Formula: |
C4H10O3 |
Molecular Weight: |
106.14 |
Specification: |
|
InChI: |
InChI:1S/C4H10O3/c1-5-4(6-2)7-3/h4H,1-3H3 |
Synonyms: |
Methyl orthoformate;Orthoformic acid trimethyl ester;Thrimethyl orthoformate;Trimethoxymethane;Trimethyl ortho formate;methoxymethanediol;Trimethyl Orthoformate(TMOF); |
Molecular Structure: |
![Trimethyl orthoformate 149-73-5](https://images-a.chemnet.com/suppliers/chembase/321/3211.gif) |
if you are sourcing Trimethyl orthoformate from China ,just feel free to inquire