111Category: |
Intermediates/Pharmaceutical intermediates |
|
CAS NO: |
94-05-3 |
EC NO: |
202-299-5 |
Molecular Formula: |
C8H11NO3 |
Molecular Weight: |
169.1778 |
Specification: |
98%min |
InChI: |
InChI=1/C8H11NO3/c1-3-11-6-7(5-9)8(10)12-4-2/h6H,3-4H2,1-2H3/b7-6+ |
Packing: |
200kg/Iron Drum |
Product description:
Commodity: Ethyl (ethoxymethylene)cyanoacetate CAS#:94-05-3 Molecular Formula:C8H11NO3 Structural Formula:
Uses:Intermediate of allopurinol Specifications: Item | Standard | Appearance | Off-white solide | Assay(GC) | ≥98.0% | Loss of drying | ≤0.5% | Residue on ignition | ≤0.5% | Melting point | 48-51℃ |
|
Uses: |
Intermediate of allopurinol, and also can be used for the intermediate of Pyrazosulfuron-ethyl |
Synonyms: |
Ethyl 2-cyano-3-ethoxyacrylate;2-Cyano-3-ethoxy-2-propenoic acid ethyl ester;Ethyl ethoxymethylenecyanoacetate;ethyl (2Z)-2-cyano-3-ethoxyprop-2-enoate;ethyl (2E)-2-cyano-3-ethoxyprop-2-enoate; |
Molecular Structure: |
|