Details for P-Hydroxyphenylacetic acid
![](/images/home/newal1.gif)
P-Hydroxyphenylacetic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
156-38-7 |
EC NO: |
205-851-3 |
Molecular Formula: |
C8H8O3 |
Molecular Weight: |
152.1399 |
Specification: |
|
InChI: |
InChI=1/C8H8O3/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4,9H,5H2,(H,10,11)/p-1 |
Synonyms: |
p-Hydroxyphenylacetic acid;p-Hydroxy Phenyl Acetic Acid;(4-hydroxyphenyl)acetate;4-Hydroxybenzeneacetic acid;Para Hydroxy Phenyl Acetic acid; |
Molecular Structure: |
![P-Hydroxyphenylacetic acid 156-38-7](https://images-a.chemnet.com/suppliers/chembase/173/1733.gif) |
if you are sourcing P-Hydroxyphenylacetic acid from China ,just feel free to inquire