Details for Fluorescent Brightener SWN
![](/images/home/newal1.gif)
Fluorescent Brightener SWN
111Category: |
Catalyst and Auxiliary/Textile Auxiliary Agent |
|
CAS NO: |
91-44-1 |
EC NO: |
202-068-9 |
Molecular Formula: |
C14H17NO2 |
Molecular Weight: |
231.29 |
Specification: |
|
InChI: |
InChI=1/C14H17NO2/c1-4-15(5-2)11-6-7-12-10(3)8-14(16)17-13(12)9-11/h6-9H,4-5H2,1-3H3 |
Synonyms: |
Coumarin 1~4-Methyl-7-diethylaminocoumarin;4-Methyl-7-diethylamino coumarine;Fluorescent Brightener SWN;4-methyl-7-diethylamino Coumarin; |
Molecular Structure: |
![Fluorescent Brightener SWN 91-44-1](https://images-a.chemnet.com/suppliers/chembase/113/1132.gif) |
if you are sourcing Fluorescent Brightener SWN from China ,just feel free to inquire