Details for Solvent Red 196

Solvent Red 196
111Category: |
Dyestuffs and Pigments/Solvent Dyes |
|
CAS NO: |
52372-36-8 |
EC NO: |
257-884-8 |
Molecular Formula: |
C23H18N4O2 |
Molecular Weight: |
382.4146 |
Specification: |
|
InChI: |
InChI=1/C23H18N4O2/c1-3-26(4-2)15-10-9-14-11-16-21(29-20(14)12-15)17(13-24)23(28)27-19-8-6-5-7-18(19)25-22(16)27/h5-12H,3-4H2,1-2H3 |
Synonyms: |
Fluorescent Red BK;C.I.Solvent Red 196;fluorescence red BK;Red BK;3-(diethylamino)-7-oxo-7H-chromeno[3',2':3,4]pyrido[1,2-a]benzimidazole-6-carbonitrile;Plast red 3008; |
Molecular Structure: |
 |
if you are sourcing Solvent Red 196 from China ,just feel free to inquire