Details for Vat green 3
Vat green 3
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
3271-76-9 |
EC NO: |
221-897-7 |
Molecular Formula: |
C31H15NO3 |
Molecular Weight: |
449.4557 |
Specification: |
|
InChI: |
InChI=1/C31H15NO3/c33-29-19-6-2-1-5-15(19)16-13-14-24-26-17(9-11-22(29)25(16)26)18-10-12-23-27(28(18)32-24)31(35)21-8-4-3-7-20(21)30(23)34/h1-14,32H |
Synonyms: |
C.I. 70311;C.I. 69500;C.I. Vat Green 3anthra[2,1,9-mna]naphtho[2,3-h]acridine-5,10,15(16H)-trione;Vat Olive Green B;Vat Olive B; |
Molecular Structure: |
|
if you are sourcing Vat green 3 from China ,just feel free to inquire