Details for 2 Ethyl Hexanol
![](/images/home/newal1.gif)
2 Ethyl Hexanol
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
104-76-7 |
EC NO: |
203-234-3;248-133-5 |
Molecular Formula: |
C8H18O |
Molecular Weight: |
130.2279 |
Specification: |
|
InChI: |
InChI=1/C8H18O/c1-3-5-6-8(4-2)7-9/h8-9H,3-7H2,1-2H3/t8-/m0/s1 |
Synonyms: |
2-Ethylhexan-1-ol;2-Ethylhexanol;2-ethyl hexanol;octan-3-ol;titanium(4+) tetrakis(2-ethylhexan-1-olate);(2R)-2-ethylhexan-1-ol;(2S)-2-ethylhexan-1-ol;Isooctyl Alcohol;2-EH;ISOOCTYL ALCOHOL;
|
Molecular Structure: |
![2 Ethyl Hexanol 104-76-7](https://images-a.chemnet.com/suppliers/chembase/475/101475_1.jpg) |
if you are sourcing 2 Ethyl Hexanol from United-Kingdom ,just feel free to inquire