Details for Methyl 3-Nitro-4-Methyl benzoate

Methyl 3-Nitro-4-Methyl benzoate
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
7356-11-8 |
EC NO: |
230-886-6 |
Molecular Formula: |
C9H9NO4 |
Molecular Weight: |
195.17 |
Specification: |
|
InChI: |
InChI=1/C9H9NO4/c1-6-3-4-7(9(11)14-2)5-8(6)10(12)13/h3-5H,1-2H3 |
Synonyms: |
Methyl 3-Nitro-4-Methyl benzoate;4-methyl-3-nitrobenzoic acid methyl ester;Methyl3-Nitro-4-Methylbenzoate; |
Molecular Structure: |
 |
if you are sourcing Methyl 3-Nitro-4-Methyl benzoate from China ,just feel free to inquire