Details for Methyl 4-Nitro-3-Methyl benzoate
![](/images/home/newal1.gif)
Methyl 4-Nitro-3-Methyl benzoate
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
24078-21-5 |
EC NO: |
230-886-6 |
Molecular Formula: |
C9H9NO4 |
Molecular Weight: |
195.1721 |
Specification: |
|
InChI: |
InChI=1/C9H9NO4/c1-6-5-7(9(11)14-2)3-4-8(6)10(12)13/h3-5H,1-2H3 |
Synonyms: |
3-Methyl-4-Nitrobenzoic Acid Methyl Ester;Methyl 4-Nitro-3-Methyl benzoate;methyl 4-methyl-3-nitrobenzoate;N-PROPYL-4-METHYL-6-CARBOXY-BENZIMIDAZOLE£»4-Nitro-m-toluic acid methyl ester;BUTTPARK 62\04-20; |
Molecular Structure: |
![Methyl 4-Nitro-3-Methyl benzoate 24078-21-5](https://images-a.chemnet.com/suppliers/chembase/176/176356_1.gif) |
if you are sourcing Methyl 4-Nitro-3-Methyl benzoate from China ,just feel free to inquire